C4H4Cl2O4 — CID 54221971
1,4-dichloro-1,4-dihydroxybutane-2,3-dione (PubChem CID 54221971) has the molecular formula C4H4Cl2O4 and a molecular weight of 186.98 g/mol. Its IUPAC name is 1,4-dichloro-1,4-dihydroxybutane-2,3-dione.
| Compound Name | 1,4-dichloro-1,4-dihydroxybutane-2,3-dione |
|---|---|
| PubChem CID | 54221971 |
| Molecular Formula | C4H4Cl2O4 |
| Molecular Weight | 186.98 g/mol |
| Exact Mass | 185.95 |
| IUPAC Name | 1,4-dichloro-1,4-dihydroxybutane-2,3-dione |
| SMILES | O=C(C(=O)C(O)Cl)C(O)Cl |
| InChI | InChI=1S/C4H4Cl2O4/c5-3(9)1(7)2(8)4(6)10/h3-4,9-10H |
| InChIKey | QDFXFUJUAGFASF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.98 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|