C6H4N6O2S2 — CID 54223050
1-S,2-S-bis(2H-triazol-4-yl) ethanebis(thioate) (PubChem CID 54223050) has the molecular formula C6H4N6O2S2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 1-S,2-S-bis(2H-triazol-4-yl) ethanebis(thioate).
| Compound Name | 1-S,2-S-bis(2H-triazol-4-yl) ethanebis(thioate) |
|---|---|
| PubChem CID | 54223050 |
| Molecular Formula | C6H4N6O2S2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 1-S,2-S-bis(2H-triazol-4-yl) ethanebis(thioate) |
| SMILES | O=C(Sc1cn[nH]n1)C(=O)Sc1cn[nH]n1 |
| InChI | InChI=1S/C6H4N6O2S2/c13-5(15-3-1-7-11-9-3)6(14)16-4-2-8-12-10-4/h1-2H,(H,7,9,11)(H,8,10,12) |
| InChIKey | QDYLKBHUMJVKFL-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|