About 4-phenylsulfanyl-2H-triazole;silver
4-phenylsulfanyl-2H-triazole;silver (PubChem CID 87874372) has the molecular formula C8H7AgN3S
and a molecular weight of 285.10 g/mol. Its IUPAC name is 4-phenylsulfanyl-2H-triazole;silver.
Molecular Properties
| Compound Name | 4-phenylsulfanyl-2H-triazole;silver |
| PubChem CID | 87874372 |
| Molecular Formula | C8H7AgN3S |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 283.94 |
| IUPAC Name | 4-phenylsulfanyl-2H-triazole;silver |
| SMILES | [Ag].c1ccc(Sc2cn[nH]n2)cc1 |
| InChI | InChI=1S/C8H7N3S.Ag/c1-2-4-7(5-3-1)12-8-6-9-11-10-8;/h1-6H,(H,9,10,11); |
| InChIKey | XYYWIUGRJXCWJC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenylsulfanyl-2H-triazole;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylsulfanyl-2H-triazole;silver?
The IUPAC name of 4-phenylsulfanyl-2H-triazole;silver (CID 87874372) is 4-phenylsulfanyl-2H-triazole;silver.
What is the SMILES notation for 4-phenylsulfanyl-2H-triazole;silver?
The canonical SMILES for 4-phenylsulfanyl-2H-triazole;silver is [Ag].c1ccc(Sc2cn[nH]n2)cc1.
What is the InChIKey of 4-phenylsulfanyl-2H-triazole;silver?
The InChIKey is XYYWIUGRJXCWJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3S.Ag/c1-2-4-7(5-3-1)12-8-6-9-11-10-8;/h1-6H,(H,9,10,11);.
What are the key properties of 4-phenylsulfanyl-2H-triazole;silver?
4-phenylsulfanyl-2H-triazole;silver has a molecular weight of 285.10 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylsulfanyl-2H-triazole;silver is sourced from PubChem (CID 87874372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).