C9H6F2O — CID 54224755
3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 54224755) has the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. Its IUPAC name is 3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | 3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 54224755 |
| Molecular Formula | C9H6F2O |
| Molecular Weight | 168.14 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | O=Cc1ccc(=CF)c(=CF)c1 |
| InChI | InChI=1S/C9H6F2O/c10-4-8-2-1-7(6-12)3-9(8)5-11/h1-6H |
| InChIKey | QFBMGJAVZKCXOW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.14 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|