C13H23F3N3O3PS — CID 54232153
2-[[bis(butan-2-ylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 54232153) has the molecular formula C13H23F3N3O3PS and a molecular weight of 389.38 g/mol. Its IUPAC name is 2-[[bis(butan-2-ylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid.
| Compound Name | 2-[[bis(butan-2-ylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 54232153 |
| Molecular Formula | C13H23F3N3O3PS |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-[[bis(butan-2-ylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | CCC(C)NC(NC(C)CC)(P=S)N(CC(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H23F3N3O3PS/c1-5-8(3)17-13(23-24,18-9(4)6-2)19(7-10(20)21)11(22)12(14,15)16/h8-9,17-18H,5-7H2,1-4H3,(H,20,21) |
| InChIKey | LDCNLGRPBVROEL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|