C14H15FN2O4S — CID 54232423
S-[4-[(5S)-5-acetamido-4-methyl-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl] ethanethioate (PubChem CID 54232423) has the molecular formula C14H15FN2O4S and a molecular weight of 326.35 g/mol. Its IUPAC name is S-[4-[(5S)-5-acetamido-4-methyl-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl] ethanethioate.
| Compound Name | S-[4-[(5S)-5-acetamido-4-methyl-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl] ethanethioate |
|---|---|
| PubChem CID | 54232423 |
| Molecular Formula | C14H15FN2O4S |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | S-[4-[(5S)-5-acetamido-4-methyl-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl] ethanethioate |
| SMILES | CC(=O)N[C@H]1OC(=O)N(c2ccc(SC(C)=O)c(F)c2)C1C |
| InChI | InChI=1S/C14H15FN2O4S/c1-7-13(16-8(2)18)21-14(20)17(7)10-4-5-12(11(15)6-10)22-9(3)19/h4-7,13H,1-3H3,(H,16,18)/t7?,13-/m0/s1 |
| InChIKey | QKEXQSMFQHUCLM-GRSHUZJTSA-N |
| XLogP | 2.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|