C18H23FN4O16 — CID 143689720
N-[[3-[4-(4-acetyl-2,2,3,3,5,5,6,6-octahydroxypiperazin-1-yl)-3-fluorophenyl]-4,4-dihydroxy-2-oxo-1,3-oxazolidin-5-yl]-dihydroxymethyl]acetamide (PubChem CID 143689720) has the molecular formula C18H23FN4O16 and a molecular weight of 570.39 g/mol. Its IUPAC name is N-[[3-[4-(4-acetyl-2,2,3,3,5,5,6,6-octahydroxypiperazin-1-yl)-3-fluorophenyl]-4,4-dihydroxy-2-oxo-1,3-oxazolidin-5-yl]-dihydroxymethyl]acetamide.
| Compound Name | N-[[3-[4-(4-acetyl-2,2,3,3,5,5,6,6-octahydroxypiperazin-1-yl)-3-fluorophenyl]-4,4-dihydroxy-2-oxo-1,3-oxazolidin-5-yl]-dihydroxymethyl]acetamide |
|---|---|
| PubChem CID | 143689720 |
| Molecular Formula | C18H23FN4O16 |
| Molecular Weight | 570.39 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | N-[[3-[4-(4-acetyl-2,2,3,3,5,5,6,6-octahydroxypiperazin-1-yl)-3-fluorophenyl]-4,4-dihydroxy-2-oxo-1,3-oxazolidin-5-yl]-dihydroxymethyl]acetamide |
| SMILES | CC(=O)NC(O)(O)C1OC(=O)N(c2ccc(N3C(O)(O)C(O)(O)N(C(C)=O)C(O)(O)C3(O)O)c(F)c2)C1(O)O |
| InChI | InChI=1S/C18H23FN4O16/c1-6(24)20-13(27,28)11-14(29,30)21(12(26)39-11)8-3-4-10(9(19)5-8)23-17(35,36)15(31,32)22(7(2)25)16(33,34)18(23,37)38/h3-5,11,27-38H,1-2H3,(H,20,24) |
| InChIKey | MIKRYCBSOFKTKY-UHFFFAOYSA-N |
| XLogP | -7.21 |
| TPSA | 324.95 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.39 |
| LogP ≤ 5 | -7.21 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|