C26H31N3O9 — CID 54233233
4,5-dimethoxypyridine-2-carbaldehyde;(E)-4-(4,5-dimethoxy-2-pyridinyl)but-3-en-2-one;2-(hydroxymethyl)-5-methoxy-1H-pyridin-4-one (PubChem CID 54233233) has the molecular formula C26H31N3O9 and a molecular weight of 529.55 g/mol. Its IUPAC name is 4,5-dimethoxypyridine-2-carbaldehyde;(E)-4-(4,5-dimethoxy-2-pyridinyl)but-3-en-2-one;2-(hydroxymethyl)-5-methoxy-1H-pyridin-4-one.
| Compound Name | 4,5-dimethoxypyridine-2-carbaldehyde;(E)-4-(4,5-dimethoxy-2-pyridinyl)but-3-en-2-one;2-(hydroxymethyl)-5-methoxy-1H-pyridin-4-one |
|---|---|
| PubChem CID | 54233233 |
| Molecular Formula | C26H31N3O9 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 4,5-dimethoxypyridine-2-carbaldehyde;(E)-4-(4,5-dimethoxy-2-pyridinyl)but-3-en-2-one;2-(hydroxymethyl)-5-methoxy-1H-pyridin-4-one |
| SMILES | COc1c[nH]c(CO)cc1=O.COc1cnc(/C=C/C(C)=O)cc1OC.COc1cnc(C=O)cc1OC |
| InChI | InChI=1S/C11H13NO3.C8H9NO3.C7H9NO3/c1-8(13)4-5-9-6-10(14-2)11(15-3)7-12-9;1-11-7-3-6(5-10)9-4-8(7)12-2;1-11-7-3-8-5(4-9)2-6(7)10/h4-7H,1-3H3;3-5H,1-2H3;2-3,9H,4H2,1H3,(H,8,10)/b5-4+;; |
| InChIKey | QKSUHGDTBADXGM-SFKRKKMESA-N |
| XLogP | 2.49 |
| TPSA | 159.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|