C11H17NO3 — CID 143811555
4,5-dimethoxypyridine-2-carbaldehyde;propane (PubChem CID 143811555) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4,5-dimethoxypyridine-2-carbaldehyde;propane.
| Compound Name | 4,5-dimethoxypyridine-2-carbaldehyde;propane |
|---|---|
| PubChem CID | 143811555 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4,5-dimethoxypyridine-2-carbaldehyde;propane |
| SMILES | CCC.COc1cnc(C=O)cc1OC |
| InChI | InChI=1S/C8H9NO3.C3H8/c1-11-7-3-6(5-10)9-4-8(7)12-2;1-3-2/h3-5H,1-2H3;3H2,1-2H3 |
| InChIKey | XVXJJDCHBMFTEM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|