C5H16N4 — CID 54233846
pentane-1,2,3,5-tetramine (PubChem CID 54233846) has the molecular formula C5H16N4 and a molecular weight of 132.21 g/mol. Its IUPAC name is pentane-1,2,3,5-tetramine.
| Compound Name | pentane-1,2,3,5-tetramine |
|---|---|
| PubChem CID | 54233846 |
| Molecular Formula | C5H16N4 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.14 |
| IUPAC Name | pentane-1,2,3,5-tetramine |
| SMILES | NCCC(N)C(N)CN |
| InChI | InChI=1S/C5H16N4/c6-2-1-4(8)5(9)3-7/h4-5H,1-3,6-9H2 |
| InChIKey | QLDMTQBLMDCKER-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |