C26H27NO3S — CID 54236446
(2S,3R)-2-amino-3-[9-(3-cyclopentylthiophen-2-yl)fluoren-9-yl]oxybutanoic acid (PubChem CID 54236446) has the molecular formula C26H27NO3S and a molecular weight of 433.57 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-[9-(3-cyclopentylthiophen-2-yl)fluoren-9-yl]oxybutanoic acid.
| Compound Name | (2S,3R)-2-amino-3-[9-(3-cyclopentylthiophen-2-yl)fluoren-9-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 54236446 |
| Molecular Formula | C26H27NO3S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (2S,3R)-2-amino-3-[9-(3-cyclopentylthiophen-2-yl)fluoren-9-yl]oxybutanoic acid |
| SMILES | C[C@@H](OC1(c2sccc2C2CCCC2)c2ccccc2-c2ccccc21)[C@H](N)C(=O)O |
| InChI | InChI=1S/C26H27NO3S/c1-16(23(27)25(28)29)30-26(24-18(14-15-31-24)17-8-2-3-9-17)21-12-6-4-10-19(21)20-11-5-7-13-22(20)26/h4-7,10-17,23H,2-3,8-9,27H2,1H3,(H,28,29)/t16-,23+/m1/s1 |
| InChIKey | QMXITZYNCGUANT-MWTRTKDXSA-N |
| XLogP | 5.49 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |