C25H27NO3S — CID 70055257
(2S)-2-amino-3-(2-tert-butyl-9-thiophen-2-ylfluoren-9-yl)oxybutanoic acid (PubChem CID 70055257) has the molecular formula C25H27NO3S and a molecular weight of 421.56 g/mol. Its IUPAC name is (2S)-2-amino-3-(2-tert-butyl-9-thiophen-2-ylfluoren-9-yl)oxybutanoic acid.
| Compound Name | (2S)-2-amino-3-(2-tert-butyl-9-thiophen-2-ylfluoren-9-yl)oxybutanoic acid |
|---|---|
| PubChem CID | 70055257 |
| Molecular Formula | C25H27NO3S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (2S)-2-amino-3-(2-tert-butyl-9-thiophen-2-ylfluoren-9-yl)oxybutanoic acid |
| SMILES | CC(OC1(c2cccs2)c2ccccc2-c2ccc(C(C)(C)C)cc21)[C@H](N)C(=O)O |
| InChI | InChI=1S/C25H27NO3S/c1-15(22(26)23(27)28)29-25(21-10-7-13-30-21)19-9-6-5-8-17(19)18-12-11-16(14-20(18)25)24(2,3)4/h5-15,22H,26H2,1-4H3,(H,27,28)/t15?,22-,25?/m0/s1 |
| InChIKey | SELKYRFLGBPGMD-BMHWKYIMSA-N |
| XLogP | 5.13 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |