C27H23NO3S — CID 70052744
(2S)-2-amino-3-(2-phenyl-9-thiophen-2-ylfluoren-9-yl)oxybutanoic acid (PubChem CID 70052744) has the molecular formula C27H23NO3S and a molecular weight of 441.55 g/mol. Its IUPAC name is (2S)-2-amino-3-(2-phenyl-9-thiophen-2-ylfluoren-9-yl)oxybutanoic acid.
| Compound Name | (2S)-2-amino-3-(2-phenyl-9-thiophen-2-ylfluoren-9-yl)oxybutanoic acid |
|---|---|
| PubChem CID | 70052744 |
| Molecular Formula | C27H23NO3S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (2S)-2-amino-3-(2-phenyl-9-thiophen-2-ylfluoren-9-yl)oxybutanoic acid |
| SMILES | CC(OC1(c2cccs2)c2ccccc2-c2ccc(-c3ccccc3)cc21)[C@H](N)C(=O)O |
| InChI | InChI=1S/C27H23NO3S/c1-17(25(28)26(29)30)31-27(24-12-7-15-32-24)22-11-6-5-10-20(22)21-14-13-19(16-23(21)27)18-8-3-2-4-9-18/h2-17,25H,28H2,1H3,(H,29,30)/t17?,25-,27?/m0/s1 |
| InChIKey | FHKJGOHFCSQQLL-PYOKQCAZSA-N |
| XLogP | 5.50 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |