C29H44O4 — CID 54237116
(1S,3S,9S,10R,13S,14S)-17-ethyl-3-(4-ethyl-4-hydroxyhex-2-enoxy)-10,13-dimethyl-1,2,4,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-1,3-diol (PubChem CID 54237116) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is (1S,3S,9S,10R,13S,14S)-17-ethyl-3-(4-ethyl-4-hydroxyhex-2-enoxy)-10,13-dimethyl-1,2,4,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (1S,3S,9S,10R,13S,14S)-17-ethyl-3-(4-ethyl-4-hydroxyhex-2-enoxy)-10,13-dimethyl-1,2,4,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 54237116 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | (1S,3S,9S,10R,13S,14S)-17-ethyl-3-(4-ethyl-4-hydroxyhex-2-enoxy)-10,13-dimethyl-1,2,4,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-1,3-diol |
| SMILES | CCC1=CC[C@H]2C3=CC=C4C[C@](O)(OCC=CC(O)(CC)CC)C[C@H](O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H44O4/c1-6-20-11-13-23-22-12-10-21-18-29(32,33-17-9-15-28(31,7-2)8-3)19-25(30)27(21,5)24(22)14-16-26(20,23)4/h9-12,15,23-25,30-32H,6-8,13-14,16-19H2,1-5H3/t23-,24-,25-,26+,27-,29-/m0/s1 |
| InChIKey | QNITXVMFVORRMD-BZRLWTRBSA-N |
| XLogP | 5.60 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|