C15H12Cl2OS — CID 54240736
1-(4,5-dichloro-2-methylphenyl)-4-thiophen-2-ylbut-2-en-1-one (PubChem CID 54240736) has the molecular formula C15H12Cl2OS and a molecular weight of 311.23 g/mol. Its IUPAC name is 1-(4,5-dichloro-2-methylphenyl)-4-thiophen-2-ylbut-2-en-1-one.
| Compound Name | 1-(4,5-dichloro-2-methylphenyl)-4-thiophen-2-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 54240736 |
| Molecular Formula | C15H12Cl2OS |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 1-(4,5-dichloro-2-methylphenyl)-4-thiophen-2-ylbut-2-en-1-one |
| SMILES | Cc1cc(Cl)c(Cl)cc1C(=O)C=CCc1cccs1 |
| InChI | InChI=1S/C15H12Cl2OS/c1-10-8-13(16)14(17)9-12(10)15(18)6-2-4-11-5-3-7-19-11/h2-3,5-9H,4H2,1H3 |
| InChIKey | QPUQNPBWVFOYIF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|