C11H10ClN3O3S2 — CID 54242620
ethyl N-[[3-(2-chlorophenyl)-1,2,4-thiadiazol-5-yl]sulfonyl]methanimidate (PubChem CID 54242620) has the molecular formula C11H10ClN3O3S2 and a molecular weight of 331.81 g/mol. Its IUPAC name is ethyl N-[[3-(2-chlorophenyl)-1,2,4-thiadiazol-5-yl]sulfonyl]methanimidate.
| Compound Name | ethyl N-[[3-(2-chlorophenyl)-1,2,4-thiadiazol-5-yl]sulfonyl]methanimidate |
|---|---|
| PubChem CID | 54242620 |
| Molecular Formula | C11H10ClN3O3S2 |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | ethyl N-[[3-(2-chlorophenyl)-1,2,4-thiadiazol-5-yl]sulfonyl]methanimidate |
| SMILES | CCOC=NS(=O)(=O)c1nc(-c2ccccc2Cl)ns1 |
| InChI | InChI=1S/C11H10ClN3O3S2/c1-2-18-7-13-20(16,17)11-14-10(15-19-11)8-5-3-4-6-9(8)12/h3-7H,2H2,1H3 |
| InChIKey | QRBLZFZZBJWGRY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|