C73H80N4O12 — CID 54243418
[1,7-bis[(dibenzylamino)oxy]-4,4-bis[3-(dibenzylamino)oxy-1-formyloxypropyl]-5-formyloxyheptan-3-yl] formate (PubChem CID 54243418) has the molecular formula C73H80N4O12 and a molecular weight of 1205.46 g/mol. Its IUPAC name is [1,7-bis[(dibenzylamino)oxy]-4,4-bis[3-(dibenzylamino)oxy-1-formyloxypropyl]-5-formyloxyheptan-3-yl] formate.
| Compound Name | [1,7-bis[(dibenzylamino)oxy]-4,4-bis[3-(dibenzylamino)oxy-1-formyloxypropyl]-5-formyloxyheptan-3-yl] formate |
|---|---|
| PubChem CID | 54243418 |
| Molecular Formula | C73H80N4O12 |
| Molecular Weight | 1205.46 g/mol |
| Exact Mass | 1204.58 |
| IUPAC Name | [1,7-bis[(dibenzylamino)oxy]-4,4-bis[3-(dibenzylamino)oxy-1-formyloxypropyl]-5-formyloxyheptan-3-yl] formate |
| SMILES | O=COC(CCON(Cc1ccccc1)Cc1ccccc1)C(C(CCON(Cc1ccccc1)Cc1ccccc1)OC=O)(C(CCON(Cc1ccccc1)Cc1ccccc1)OC=O)C(CCON(Cc1ccccc1)Cc1ccccc1)OC=O |
| InChI | InChI=1S/C73H80N4O12/c78-57-82-69(41-45-86-74(49-61-25-9-1-10-26-61)50-62-27-11-2-12-28-62)73(70(83-58-79)42-46-87-75(51-63-29-13-3-14-30-63)52-64-31-15-4-16-32-64,71(84-59-80)43-47-88-76(53-65-33-17-5-18-34-65)54-66-35-19-6-20-36-66)72(85-60-81)44-48-89-77(55-67-37-21-7-22-38-67)56-68-39-23-8-24-40-68/h1-40,57-60,69-72H,41-56H2 |
| InChIKey | QROUCAAKTNNPQY-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 155.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 89 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1205.46 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|