About CID 101352009
CID 101352009 (PubChem CID 101352009) has the molecular formula C15H14F3NO3S+
and a molecular weight of 345.34 g/mol.
Molecular Properties
| Compound Name | CID 101352009 |
| PubChem CID | 101352009 |
| Molecular Formula | C15H14F3NO3S+ |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | — |
| SMILES | [O][S+](=O)(ON(Cc1ccccc1)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H14F3NO3S/c16-15(17,18)23(20,21)22-19(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2/q+1 |
| InChIKey | LLYVYHSZNKRNQP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 101352009 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101352009?
The IUPAC name of CID 101352009 (CID 101352009) is not available.
What is the SMILES notation for CID 101352009?
The canonical SMILES for CID 101352009 is [O][S+](=O)(ON(Cc1ccccc1)Cc1ccccc1)C(F)(F)F.
What is the InChIKey of CID 101352009?
The InChIKey is LLYVYHSZNKRNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F3NO3S/c16-15(17,18)23(20,21)22-19(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2/q+1.
What are the key properties of CID 101352009?
CID 101352009 has a molecular weight of 345.34 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101352009 is sourced from PubChem (CID 101352009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).