About CID 25013086
CID 25013086 (PubChem CID 25013086) has the molecular formula C15H15BF7NOS
and a molecular weight of 401.16 g/mol.
Molecular Properties
| Compound Name | CID 25013086 |
| PubChem CID | 25013086 |
| Molecular Formula | C15H15BF7NOS |
| Molecular Weight | 401.16 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | — |
| SMILES | CN(Cc1ccccc1)[S+](=O)(c1ccccc1)C(F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C15H15F3NOS.BF4/c1-19(12-13-8-4-2-5-9-13)21(20,15(16,17)18)14-10-6-3-7-11-14;2-1(3,4)5/h2-11H,12H2,1H3;/q+1;-1 |
| InChIKey | JCAZRBLFEZJQAV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.16 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 25013086 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 25013086?
The IUPAC name of CID 25013086 (CID 25013086) is not available.
What is the SMILES notation for CID 25013086?
The canonical SMILES for CID 25013086 is CN(Cc1ccccc1)[S+](=O)(c1ccccc1)C(F)(F)F.F[B-](F)(F)F.
What is the InChIKey of CID 25013086?
The InChIKey is JCAZRBLFEZJQAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3NOS.BF4/c1-19(12-13-8-4-2-5-9-13)21(20,15(16,17)18)14-10-6-3-7-11-14;2-1(3,4)5/h2-11H,12H2,1H3;/q+1;-1.
What are the key properties of CID 25013086?
CID 25013086 has a molecular weight of 401.16 g/mol, XLogP of 5.41, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 25013086 is sourced from PubChem (CID 25013086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).