About O-(dibenzylamino) carbamothioate
O-(dibenzylamino) carbamothioate (PubChem CID 175100548) has the molecular formula C15H16N2OS
and a molecular weight of 272.37 g/mol. Its IUPAC name is O-(dibenzylamino) carbamothioate.
Molecular Properties
| Compound Name | O-(dibenzylamino) carbamothioate |
| PubChem CID | 175100548 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | O-(dibenzylamino) carbamothioate |
| SMILES | NC(=S)ON(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H16N2OS/c16-15(19)18-17(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,16,19) |
| InChIKey | LXIUUIYTLJNNEJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(dibenzylamino) carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(dibenzylamino) carbamothioate?
The IUPAC name of O-(dibenzylamino) carbamothioate (CID 175100548) is O-(dibenzylamino) carbamothioate.
What is the SMILES notation for O-(dibenzylamino) carbamothioate?
The canonical SMILES for O-(dibenzylamino) carbamothioate is NC(=S)ON(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of O-(dibenzylamino) carbamothioate?
The InChIKey is LXIUUIYTLJNNEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2OS/c16-15(19)18-17(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,16,19).
What are the key properties of O-(dibenzylamino) carbamothioate?
O-(dibenzylamino) carbamothioate has a molecular weight of 272.37 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(dibenzylamino) carbamothioate is sourced from PubChem (CID 175100548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).