C24H31NO2S — CID 54244837
N-ethyl-N-(furan-2-ylmethyl)-6,6-dimethyl-5-(3-thiophen-3-ylprop-2-enoxymethyl)hept-4-en-2-yn-1-amine (PubChem CID 54244837) has the molecular formula C24H31NO2S and a molecular weight of 397.58 g/mol. Its IUPAC name is N-ethyl-N-(furan-2-ylmethyl)-6,6-dimethyl-5-(3-thiophen-3-ylprop-2-enoxymethyl)hept-4-en-2-yn-1-amine.
| Compound Name | N-ethyl-N-(furan-2-ylmethyl)-6,6-dimethyl-5-(3-thiophen-3-ylprop-2-enoxymethyl)hept-4-en-2-yn-1-amine |
|---|---|
| PubChem CID | 54244837 |
| Molecular Formula | C24H31NO2S |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N-ethyl-N-(furan-2-ylmethyl)-6,6-dimethyl-5-(3-thiophen-3-ylprop-2-enoxymethyl)hept-4-en-2-yn-1-amine |
| SMILES | CCN(CC#CC=C(COCC=Cc1ccsc1)C(C)(C)C)Cc1ccco1 |
| InChI | InChI=1S/C24H31NO2S/c1-5-25(18-23-12-9-16-27-23)14-7-6-11-22(24(2,3)4)19-26-15-8-10-21-13-17-28-20-21/h8-13,16-17,20H,5,14-15,18-19H2,1-4H3 |
| InChIKey | QSNBIJLTCUDMMB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|