C12H21NO5S — CID 54249253
(2,5-dihydroxypyrrol-1-yl) octane-1-sulfonate (PubChem CID 54249253) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) octane-1-sulfonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) octane-1-sulfonate |
|---|---|
| PubChem CID | 54249253 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C12H21NO5S/c1-2-3-4-5-6-7-10-19(16,17)18-13-11(14)8-9-12(13)15/h8-9,14-15H,2-7,10H2,1H3 |
| InChIKey | QVOLUJDTJPQXPL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|