About 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene
1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene (PubChem CID 54250665) has the molecular formula C11H11F3O
and a molecular weight of 216.20 g/mol. Its IUPAC name is 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene.
Molecular Properties
| Compound Name | 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene |
| PubChem CID | 54250665 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene |
| SMILES | CCOCC(F)=C(F)c1ccccc1F |
| InChI | InChI=1S/C11H11F3O/c1-2-15-7-10(13)11(14)8-5-3-4-6-9(8)12/h3-6H,2,7H2,1H3 |
| InChIKey | QWMNVZCCHRUIAW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene?
The IUPAC name of 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene (CID 54250665) is 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene.
What is the SMILES notation for 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene?
The canonical SMILES for 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene is CCOCC(F)=C(F)c1ccccc1F.
What is the InChIKey of 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene?
The InChIKey is QWMNVZCCHRUIAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3O/c1-2-15-7-10(13)11(14)8-5-3-4-6-9(8)12/h3-6H,2,7H2,1H3.
What are the key properties of 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene?
1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene has a molecular weight of 216.20 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxy-1,2-difluoroprop-1-enyl)-2-fluorobenzene is sourced from PubChem (CID 54250665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).