C18H20O4 — CID 54251362
2,6-dipropylnaphthalene-1,3-dicarboxylic acid (PubChem CID 54251362) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2,6-dipropylnaphthalene-1,3-dicarboxylic acid.
| Compound Name | 2,6-dipropylnaphthalene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 54251362 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2,6-dipropylnaphthalene-1,3-dicarboxylic acid |
| SMILES | CCCc1ccc2c(C(=O)O)c(CCC)c(C(=O)O)cc2c1 |
| InChI | InChI=1S/C18H20O4/c1-3-5-11-7-8-13-12(9-11)10-15(17(19)20)14(6-4-2)16(13)18(21)22/h7-10H,3-6H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | QWZFECYNZHBSLN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |