C15H16O3 — CID 67125228
6-(3-hydroxybutyl)naphthalene-1-carboxylic acid (PubChem CID 67125228) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 6-(3-hydroxybutyl)naphthalene-1-carboxylic acid.
| Compound Name | 6-(3-hydroxybutyl)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 67125228 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 6-(3-hydroxybutyl)naphthalene-1-carboxylic acid |
| SMILES | CC(O)CCc1ccc2c(C(=O)O)cccc2c1 |
| InChI | InChI=1S/C15H16O3/c1-10(16)5-6-11-7-8-13-12(9-11)3-2-4-14(13)15(17)18/h2-4,7-10,16H,5-6H2,1H3,(H,17,18) |
| InChIKey | LQCHVYXQEOVAGA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |