C27H33NO4S — CID 130253131
6-[8-[5-(2-aminoethyl)thiophene-2-carbonyl]oxynonyl]naphthalene-1-carboxylic acid (PubChem CID 130253131) has the molecular formula C27H33NO4S and a molecular weight of 467.63 g/mol. Its IUPAC name is 6-[8-[5-(2-aminoethyl)thiophene-2-carbonyl]oxynonyl]naphthalene-1-carboxylic acid.
| Compound Name | 6-[8-[5-(2-aminoethyl)thiophene-2-carbonyl]oxynonyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 130253131 |
| Molecular Formula | C27H33NO4S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 6-[8-[5-(2-aminoethyl)thiophene-2-carbonyl]oxynonyl]naphthalene-1-carboxylic acid |
| SMILES | CC(CCCCCCCc1ccc2c(C(=O)O)cccc2c1)OC(=O)c1ccc(CCN)s1 |
| InChI | InChI=1S/C27H33NO4S/c1-19(32-27(31)25-15-13-22(33-25)16-17-28)8-5-3-2-4-6-9-20-12-14-23-21(18-20)10-7-11-24(23)26(29)30/h7,10-15,18-19H,2-6,8-9,16-17,28H2,1H3,(H,29,30) |
| InChIKey | ZYNXOYHOZFVLOX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|