About 2-(butylamino)butanal
2-(butylamino)butanal (PubChem CID 54251429) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-(butylamino)butanal.
Molecular Properties
| Compound Name | 2-(butylamino)butanal |
| PubChem CID | 54251429 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-(butylamino)butanal |
| SMILES | CCCCNC(C=O)CC |
| InChI | InChI=1S/C8H17NO/c1-3-5-6-9-8(4-2)7-10/h7-9H,3-6H2,1-2H3 |
| InChIKey | MBTLOVAZYVFMBE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(butylamino)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butylamino)butanal?
The IUPAC name of 2-(butylamino)butanal (CID 54251429) is 2-(butylamino)butanal.
What is the SMILES notation for 2-(butylamino)butanal?
The canonical SMILES for 2-(butylamino)butanal is CCCCNC(C=O)CC.
What is the InChIKey of 2-(butylamino)butanal?
The InChIKey is MBTLOVAZYVFMBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-3-5-6-9-8(4-2)7-10/h7-9H,3-6H2,1-2H3.
What are the key properties of 2-(butylamino)butanal?
2-(butylamino)butanal has a molecular weight of 143.23 g/mol, XLogP of 1.35, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)butanal is sourced from PubChem (CID 54251429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).