C7H15F2N — CID 123879237
N-(1,2-difluoropropyl)butan-1-amine (PubChem CID 123879237) has the molecular formula C7H15F2N and a molecular weight of 151.20 g/mol. Its IUPAC name is N-(1,2-difluoropropyl)butan-1-amine.
| Compound Name | N-(1,2-difluoropropyl)butan-1-amine |
|---|---|
| PubChem CID | 123879237 |
| Molecular Formula | C7H15F2N |
| Molecular Weight | 151.20 g/mol |
| Exact Mass | 151.12 |
| IUPAC Name | N-(1,2-difluoropropyl)butan-1-amine |
| SMILES | CCCCNC(F)C(C)F |
| InChI | InChI=1S/C7H15F2N/c1-3-4-5-10-7(9)6(2)8/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | GKPFXZRYBVBURN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|