C32H34N6O2 — CID 54254864
1-N,1-N,2-N,2-N-tetrakis(pyridin-3-ylmethyl)cyclohexane-1,2-dicarboxamide (PubChem CID 54254864) has the molecular formula C32H34N6O2 and a molecular weight of 534.66 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N-tetrakis(pyridin-3-ylmethyl)cyclohexane-1,2-dicarboxamide.
| Compound Name | 1-N,1-N,2-N,2-N-tetrakis(pyridin-3-ylmethyl)cyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 54254864 |
| Molecular Formula | C32H34N6O2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 1-N,1-N,2-N,2-N-tetrakis(pyridin-3-ylmethyl)cyclohexane-1,2-dicarboxamide |
| SMILES | O=C(C1CCCCC1C(=O)N(Cc1cccnc1)Cc1cccnc1)N(Cc1cccnc1)Cc1cccnc1 |
| InChI | InChI=1S/C32H34N6O2/c39-31(37(21-25-7-3-13-33-17-25)22-26-8-4-14-34-18-26)29-11-1-2-12-30(29)32(40)38(23-27-9-5-15-35-19-27)24-28-10-6-16-36-20-28/h3-10,13-20,29-30H,1-2,11-12,21-24H2 |
| InChIKey | QZHYFNVVMXTQAD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |