C14H27F3N2O2 — CID 54256197
4-amino-5-cyclohexyl-1-[ethyl(methyl)amino]-1,1,2-trifluoropentane-2,3-diol (PubChem CID 54256197) has the molecular formula C14H27F3N2O2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 4-amino-5-cyclohexyl-1-[ethyl(methyl)amino]-1,1,2-trifluoropentane-2,3-diol.
| Compound Name | 4-amino-5-cyclohexyl-1-[ethyl(methyl)amino]-1,1,2-trifluoropentane-2,3-diol |
|---|---|
| PubChem CID | 54256197 |
| Molecular Formula | C14H27F3N2O2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 4-amino-5-cyclohexyl-1-[ethyl(methyl)amino]-1,1,2-trifluoropentane-2,3-diol |
| SMILES | CCN(C)C(F)(F)C(O)(F)C(O)C(N)CC1CCCCC1 |
| InChI | InChI=1S/C14H27F3N2O2/c1-3-19(2)14(16,17)13(15,21)12(20)11(18)9-10-7-5-4-6-8-10/h10-12,20-21H,3-9,18H2,1-2H3 |
| InChIKey | RAGCLAWKDYIAFX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|