C20H26N2S — CID 54262826
(2R,3R)-N-(2-ethylsulfanylphenyl)-N-methyl-2-phenylpiperidin-3-amine (PubChem CID 54262826) has the molecular formula C20H26N2S and a molecular weight of 326.51 g/mol. Its IUPAC name is (2R,3R)-N-(2-ethylsulfanylphenyl)-N-methyl-2-phenylpiperidin-3-amine.
| Compound Name | (2R,3R)-N-(2-ethylsulfanylphenyl)-N-methyl-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 54262826 |
| Molecular Formula | C20H26N2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (2R,3R)-N-(2-ethylsulfanylphenyl)-N-methyl-2-phenylpiperidin-3-amine |
| SMILES | CCSc1ccccc1N(C)[C@@H]1CCCN[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H26N2S/c1-3-23-19-14-8-7-12-17(19)22(2)18-13-9-15-21-20(18)16-10-5-4-6-11-16/h4-8,10-12,14,18,20-21H,3,9,13,15H2,1-2H3/t18-,20-/m1/s1 |
| InChIKey | RERXMNZAIXASHU-UYAOXDASSA-N |
| XLogP | 4.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |