C16H20N2S — CID 67725635
(2R,3R)-N-methyl-2-phenyl-N-thiophen-3-ylpiperidin-3-amine (PubChem CID 67725635) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is (2R,3R)-N-methyl-2-phenyl-N-thiophen-3-ylpiperidin-3-amine.
| Compound Name | (2R,3R)-N-methyl-2-phenyl-N-thiophen-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 67725635 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (2R,3R)-N-methyl-2-phenyl-N-thiophen-3-ylpiperidin-3-amine |
| SMILES | CN(c1ccsc1)[C@@H]1CCCN[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H20N2S/c1-18(14-9-11-19-12-14)15-8-5-10-17-16(15)13-6-3-2-4-7-13/h2-4,6-7,9,11-12,15-17H,5,8,10H2,1H3/t15-,16-/m1/s1 |
| InChIKey | IHXFUPRXYRAJSM-HZPDHXFCSA-N |
| XLogP | 3.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |