C5H7FN3O3P — CID 54262964
[1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid (PubChem CID 54262964) has the molecular formula C5H7FN3O3P and a molecular weight of 207.10 g/mol. Its IUPAC name is [1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid.
| Compound Name | [1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid |
|---|---|
| PubChem CID | 54262964 |
| Molecular Formula | C5H7FN3O3P |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | [1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)C=Cc1ncn[nH]1 |
| InChI | InChI=1S/C5H7FN3O3P/c6-4(13(10,11)12)1-2-5-7-3-8-9-5/h1-4H,(H,7,8,9)(H2,10,11,12) |
| InChIKey | REUGIXGWRRFGON-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|