About 3-bromo-2-oxobutanal
3-bromo-2-oxobutanal (PubChem CID 54268637) has the molecular formula C4H5BrO2
and a molecular weight of 164.99 g/mol. Its IUPAC name is 3-bromo-2-oxobutanal.
Molecular Properties
| Compound Name | 3-bromo-2-oxobutanal |
| PubChem CID | 54268637 |
| Molecular Formula | C4H5BrO2 |
| Molecular Weight | 164.99 g/mol |
| Exact Mass | 163.95 |
| IUPAC Name | 3-bromo-2-oxobutanal |
| SMILES | CC(Br)C(=O)C=O |
| InChI | InChI=1S/C4H5BrO2/c1-3(5)4(7)2-6/h2-3H,1H3 |
| InChIKey | MBHWEHSLYRPWSQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.99 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-oxobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-oxobutanal?
The IUPAC name of 3-bromo-2-oxobutanal (CID 54268637) is 3-bromo-2-oxobutanal.
What is the SMILES notation for 3-bromo-2-oxobutanal?
The canonical SMILES for 3-bromo-2-oxobutanal is CC(Br)C(=O)C=O.
What is the InChIKey of 3-bromo-2-oxobutanal?
The InChIKey is MBHWEHSLYRPWSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrO2/c1-3(5)4(7)2-6/h2-3H,1H3.
What are the key properties of 3-bromo-2-oxobutanal?
3-bromo-2-oxobutanal has a molecular weight of 164.99 g/mol, XLogP of 0.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-oxobutanal is sourced from PubChem (CID 54268637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).