C5H8O4 — CID 130737354
(3S,4S)-3,4-dihydroxy-2-oxopentanal (PubChem CID 130737354) has the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. Its IUPAC name is (3S,4S)-3,4-dihydroxy-2-oxopentanal.
| Compound Name | (3S,4S)-3,4-dihydroxy-2-oxopentanal |
|---|---|
| PubChem CID | 130737354 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (3S,4S)-3,4-dihydroxy-2-oxopentanal |
| SMILES | C[C@H](O)[C@H](O)C(=O)C=O |
| InChI | InChI=1S/C5H8O4/c1-3(7)5(9)4(8)2-6/h2-3,5,7,9H,1H3/t3-,5-/m0/s1 |
| InChIKey | ZZBJXAQVUZOHTB-UCORVYFPSA-N |
| XLogP | -1.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|