C17H15F17NO4S- — CID 54276186
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-9-[1-oxo-1-(sulfinatoamino)oxybutan-2-ylidene]tridecane (PubChem CID 54276186) has the molecular formula C17H15F17NO4S- and a molecular weight of 652.34 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-9-[1-oxo-1-(sulfinatoamino)oxybutan-2-ylidene]tridecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-9-[1-oxo-1-(sulfinatoamino)oxybutan-2-ylidene]tridecane |
|---|---|
| PubChem CID | 54276186 |
| Molecular Formula | C17H15F17NO4S- |
| Molecular Weight | 652.34 g/mol |
| Exact Mass | 652.05 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-9-[1-oxo-1-(sulfinatoamino)oxybutan-2-ylidene]tridecane |
| SMILES | CCCCC(=C(CC)C(=O)ONS(=O)[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H16F17NO4S/c1-3-5-6-8(7(4-2)9(36)39-35-40(37)38)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h35H,3-6H2,1-2H3,(H,37,38)/p-1 |
| InChIKey | JOZYALGWWWXLCN-UHFFFAOYSA-M |
| XLogP | 6.73 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.34 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|