C18H21N5O6S3 — CID 54276981
(6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-7-methylsulfanyl-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54276981) has the molecular formula C18H21N5O6S3 and a molecular weight of 499.60 g/mol. Its IUPAC name is (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-7-methylsulfanyl-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-7-methylsulfanyl-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54276981 |
| Molecular Formula | C18H21N5O6S3 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-7-methylsulfanyl-8-oxo-3-(oxolan-3-yl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)NC1(SC)C(=O)N2C(C(=O)O)=C(C3CCOC3)CS[C@H]21)c1csc(N)n1 |
| InChI | InChI=1S/C18H21N5O6S3/c1-28-22-11(10-7-32-17(19)20-10)13(24)21-18(30-2)15(27)23-12(14(25)26)9(6-31-16(18)23)8-3-4-29-5-8/h7-8,16H,3-6H2,1-2H3,(H2,19,20)(H,21,24)(H,25,26)/t8?,16-,18?/m0/s1 |
| InChIKey | ROBWZUOLHYPTIR-HMHCQBCVSA-N |
| XLogP | 0.54 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|