C10H10F3NO3S — CID 54278886
1,2,3,4-tetrahydroisoquinolin-1-yl trifluoromethanesulfonate (PubChem CID 54278886) has the molecular formula C10H10F3NO3S and a molecular weight of 281.25 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinolin-1-yl trifluoromethanesulfonate.
| Compound Name | 1,2,3,4-tetrahydroisoquinolin-1-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54278886 |
| Molecular Formula | C10H10F3NO3S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinolin-1-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1NCCc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO3S/c11-10(12,13)18(15,16)17-9-8-4-2-1-3-7(8)5-6-14-9/h1-4,9,14H,5-6H2 |
| InChIKey | RPJMSXUYPPXRPI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|