C9H13NO2 — CID 54280382
3-ethenyl-4-ethyl-1-methylpyrrole-2,5-diol (PubChem CID 54280382) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-ethenyl-4-ethyl-1-methylpyrrole-2,5-diol.
| Compound Name | 3-ethenyl-4-ethyl-1-methylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 54280382 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3-ethenyl-4-ethyl-1-methylpyrrole-2,5-diol |
| SMILES | C=Cc1c(CC)c(O)n(C)c1O |
| InChI | InChI=1S/C9H13NO2/c1-4-6-7(5-2)9(12)10(3)8(6)11/h4,11-12H,1,5H2,2-3H3 |
| InChIKey | IEPWRSOEADRTER-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |