C12H18N2Si — CID 54280384
[4-(2,5-dihydro-1H-imidazol-4-yl)phenyl]-trimethylsilane (PubChem CID 54280384) has the molecular formula C12H18N2Si and a molecular weight of 218.38 g/mol. Its IUPAC name is [4-(2,5-dihydro-1H-imidazol-4-yl)phenyl]-trimethylsilane.
| Compound Name | [4-(2,5-dihydro-1H-imidazol-4-yl)phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 54280384 |
| Molecular Formula | C12H18N2Si |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [4-(2,5-dihydro-1H-imidazol-4-yl)phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(C2=NCNC2)cc1 |
| InChI | InChI=1S/C12H18N2Si/c1-15(2,3)11-6-4-10(5-7-11)12-8-13-9-14-12/h4-7,13H,8-9H2,1-3H3 |
| InChIKey | RQJXVSZQZTYTQK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|