C26H53NO5P+ — CID 54281457
2-[hydroxy-[2-(hydroxymethyl)icosa-11,14-dienoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 54281457) has the molecular formula C26H53NO5P+ and a molecular weight of 490.69 g/mol. Its IUPAC name is 2-[hydroxy-[2-(hydroxymethyl)icosa-11,14-dienoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-(hydroxymethyl)icosa-11,14-dienoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 54281457 |
| Molecular Formula | C26H53NO5P+ |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | 2-[hydroxy-[2-(hydroxymethyl)icosa-11,14-dienoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(CO)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C26H52NO5P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26(24-28)25-32-33(29,30)31-23-22-27(2,3)4/h9-10,12-13,26,28H,5-8,11,14-25H2,1-4H3/p+1 |
| InChIKey | RRBLHVKNYKRDBE-UHFFFAOYSA-O |
| XLogP | 6.64 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|