C18H24O6 — CID 54282195
4-[3-hydroxy-1-[4-(hydroxymethyl)cyclohexyl]propoxy]carbonylbenzoic acid (PubChem CID 54282195) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is 4-[3-hydroxy-1-[4-(hydroxymethyl)cyclohexyl]propoxy]carbonylbenzoic acid.
| Compound Name | 4-[3-hydroxy-1-[4-(hydroxymethyl)cyclohexyl]propoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 54282195 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[3-hydroxy-1-[4-(hydroxymethyl)cyclohexyl]propoxy]carbonylbenzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)OC(CCO)C2CCC(CO)CC2)cc1 |
| InChI | InChI=1S/C18H24O6/c19-10-9-16(13-3-1-12(11-20)2-4-13)24-18(23)15-7-5-14(6-8-15)17(21)22/h5-8,12-13,16,19-20H,1-4,9-11H2,(H,21,22) |
| InChIKey | RROBOEREZWOISL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |