C60H40N4 — CID 54282808
5,10,15,20-tetranaphthalen-1-yl-21,22,23,24-tetrahydroporphyrin (PubChem CID 54282808) has the molecular formula C60H40N4 and a molecular weight of 817.01 g/mol. Its IUPAC name is 5,10,15,20-tetranaphthalen-1-yl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetranaphthalen-1-yl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 54282808 |
| Molecular Formula | C60H40N4 |
| Molecular Weight | 817.01 g/mol |
| Exact Mass | 816.33 |
| IUPAC Name | 5,10,15,20-tetranaphthalen-1-yl-21,22,23,24-tetrahydroporphyrin |
| SMILES | c1ccc2c(C3=c4ccc([nH]4)=C(c4cccc5ccccc45)c4ccc([nH]4)C(c4cccc5ccccc45)=c4ccc([nH]4)=C(c4cccc5ccccc45)c4ccc3[nH]4)cccc2c1 |
| InChI | InChI=1S/C60H40N4/c1-5-21-41-37(13-1)17-9-25-45(41)57-49-29-31-51(61-49)58(46-26-10-18-38-14-2-6-22-42(38)46)53-33-35-55(63-53)60(48-28-12-20-40-16-4-8-24-44(40)48)56-36-34-54(64-56)59(52-32-30-50(57)62-52)47-27-11-19-39-15-3-7-23-43(39)47/h1-36,61-64H |
| InChIKey | GWVFFGHHUAUFCK-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.01 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |