C17H31O3P — CID 54286894
7-diethoxyphosphoryltrideca-1,3,7-triene (PubChem CID 54286894) has the molecular formula C17H31O3P and a molecular weight of 314.41 g/mol. Its IUPAC name is 7-diethoxyphosphoryltrideca-1,3,7-triene.
| Compound Name | 7-diethoxyphosphoryltrideca-1,3,7-triene |
|---|---|
| PubChem CID | 54286894 |
| Molecular Formula | C17H31O3P |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 7-diethoxyphosphoryltrideca-1,3,7-triene |
| SMILES | C=CC=CCCC(=CCCCCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H31O3P/c1-5-9-11-13-15-17(16-14-12-10-6-2)21(18,19-7-3)20-8-4/h5,9,11,16H,1,6-8,10,12-15H2,2-4H3 |
| InChIKey | RUTHOXRLNZHMAE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|