C13H17N5O3 — CID 54291907
1-(3,4-dimethoxyphenyl)-6-methyl-4-(2-methylhydrazinyl)-1,3,5-triazin-2-one (PubChem CID 54291907) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-6-methyl-4-(2-methylhydrazinyl)-1,3,5-triazin-2-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-6-methyl-4-(2-methylhydrazinyl)-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 54291907 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-6-methyl-4-(2-methylhydrazinyl)-1,3,5-triazin-2-one |
| SMILES | CNNc1nc(C)n(-c2ccc(OC)c(OC)c2)c(=O)n1 |
| InChI | InChI=1S/C13H17N5O3/c1-8-15-12(17-14-2)16-13(19)18(8)9-5-6-10(20-3)11(7-9)21-4/h5-7,14H,1-4H3,(H,16,17,19) |
| InChIKey | RYCDRLHAYINAAW-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|