C66H48O10 — CID 54292392
(4-methylphenyl) 4-[4-[2,6-bis[4-(4-methylphenoxy)carbonylphenyl]pyran-4-ylidene]-6-[4-(4-methylphenoxy)carbonylphenyl]pyran-2-yl]benzoate (PubChem CID 54292392) has the molecular formula C66H48O10 and a molecular weight of 1001.10 g/mol. Its IUPAC name is (4-methylphenyl) 4-[4-[2,6-bis[4-(4-methylphenoxy)carbonylphenyl]pyran-4-ylidene]-6-[4-(4-methylphenoxy)carbonylphenyl]pyran-2-yl]benzoate.
| Compound Name | (4-methylphenyl) 4-[4-[2,6-bis[4-(4-methylphenoxy)carbonylphenyl]pyran-4-ylidene]-6-[4-(4-methylphenoxy)carbonylphenyl]pyran-2-yl]benzoate |
|---|---|
| PubChem CID | 54292392 |
| Molecular Formula | C66H48O10 |
| Molecular Weight | 1001.10 g/mol |
| Exact Mass | 1000.32 |
| IUPAC Name | (4-methylphenyl) 4-[4-[2,6-bis[4-(4-methylphenoxy)carbonylphenyl]pyran-4-ylidene]-6-[4-(4-methylphenoxy)carbonylphenyl]pyran-2-yl]benzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(C3=CC(=C4C=C(c5ccc(C(=O)Oc6ccc(C)cc6)cc5)OC(c5ccc(C(=O)Oc6ccc(C)cc6)cc5)=C4)C=C(c4ccc(C(=O)Oc5ccc(C)cc5)cc4)O3)cc2)cc1 |
| InChI | InChI=1S/C66H48O10/c1-41-5-29-55(30-6-41)71-63(67)49-21-13-45(14-22-49)59-37-53(38-60(75-59)46-15-23-50(24-16-46)64(68)72-56-31-7-42(2)8-32-56)54-39-61(47-17-25-51(26-18-47)65(69)73-57-33-9-43(3)10-34-57)76-62(40-54)48-19-27-52(28-20-48)66(70)74-58-35-11-44(4)12-36-58/h5-40H,1-4H3 |
| InChIKey | RYKOPTMQMJZVCW-UHFFFAOYSA-N |
| XLogP | 14.62 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.10 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|