C19H21F3O4 — CID 54302200
ethyl 3-ethoxy-4,4,4-trifluoro-3-hydroxy-2-(naphthalen-2-ylmethyl)butanoate (PubChem CID 54302200) has the molecular formula C19H21F3O4 and a molecular weight of 370.37 g/mol. Its IUPAC name is ethyl 3-ethoxy-4,4,4-trifluoro-3-hydroxy-2-(naphthalen-2-ylmethyl)butanoate.
| Compound Name | ethyl 3-ethoxy-4,4,4-trifluoro-3-hydroxy-2-(naphthalen-2-ylmethyl)butanoate |
|---|---|
| PubChem CID | 54302200 |
| Molecular Formula | C19H21F3O4 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl 3-ethoxy-4,4,4-trifluoro-3-hydroxy-2-(naphthalen-2-ylmethyl)butanoate |
| SMILES | CCOC(=O)C(Cc1ccc2ccccc2c1)C(O)(OCC)C(F)(F)F |
| InChI | InChI=1S/C19H21F3O4/c1-3-25-17(23)16(18(24,26-4-2)19(20,21)22)12-13-9-10-14-7-5-6-8-15(14)11-13/h5-11,16,24H,3-4,12H2,1-2H3 |
| InChIKey | SFAIFIMEKYMOBX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|