C10H13NO2 — CID 54305305
2,4-dimethyl-4,7-dihydroisoindole-1,3-diol (PubChem CID 54305305) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2,4-dimethyl-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2,4-dimethyl-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54305305 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2,4-dimethyl-4,7-dihydroisoindole-1,3-diol |
| SMILES | CC1C=CCc2c1c(O)n(C)c2O |
| InChI | InChI=1S/C10H13NO2/c1-6-4-3-5-7-8(6)10(13)11(2)9(7)12/h3-4,6,12-13H,5H2,1-2H3 |
| InChIKey | SHBOVCOIXDFWAH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|