C13H9F3N2O4 — CID 54306894
N-[(5-oxo-2H-furan-3-yl)carbamoyl]-4-(trifluoromethyl)benzamide (PubChem CID 54306894) has the molecular formula C13H9F3N2O4 and a molecular weight of 314.22 g/mol. Its IUPAC name is N-[(5-oxo-2H-furan-3-yl)carbamoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(5-oxo-2H-furan-3-yl)carbamoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 54306894 |
| Molecular Formula | C13H9F3N2O4 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-[(5-oxo-2H-furan-3-yl)carbamoyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NC(=O)c1ccc(C(F)(F)F)cc1)NC1=CC(=O)OC1 |
| InChI | InChI=1S/C13H9F3N2O4/c14-13(15,16)8-3-1-7(2-4-8)11(20)18-12(21)17-9-5-10(19)22-6-9/h1-5H,6H2,(H2,17,18,20,21) |
| InChIKey | SIDXRWINDVZHRX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |