C15H18FNO2 — CID 54311203
1-(2,6-diethylphenyl)-3-(fluoromethyl)pyrrole-2,5-diol (PubChem CID 54311203) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-(fluoromethyl)pyrrole-2,5-diol.
| Compound Name | 1-(2,6-diethylphenyl)-3-(fluoromethyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54311203 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-(fluoromethyl)pyrrole-2,5-diol |
| SMILES | CCc1cccc(CC)c1-n1c(O)cc(CF)c1O |
| InChI | InChI=1S/C15H18FNO2/c1-3-10-6-5-7-11(4-2)14(10)17-13(18)8-12(9-16)15(17)19/h5-8,18-19H,3-4,9H2,1-2H3 |
| InChIKey | SKZWEKPEICPGAA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |